C25H34N2S — CID 166908847
(3S,5S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-methyl-5-phenyladamantane-1-carbothioamide (PubChem CID 166908847) has the molecular formula C25H34N2S and a molecular weight of 394.63 g/mol. Its IUPAC name is (3S,5S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-methyl-5-phenyladamantane-1-carbothioamide.
| Compound Name | (3S,5S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-methyl-5-phenyladamantane-1-carbothioamide |
|---|---|
| PubChem CID | 166908847 |
| Molecular Formula | C25H34N2S |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (3S,5S)-N-[(3R)-1-azabicyclo[2.2.2]octan-3-yl]-3-methyl-5-phenyladamantane-1-carbothioamide |
| SMILES | C[C@@]12CC3CC(C(=S)N[C@H]4CN5CCC4CC5)(C1)C[C@](c1ccccc1)(C3)C2 |
| InChI | InChI=1S/C25H34N2S/c1-23-11-18-12-24(15-23,20-5-3-2-4-6-20)17-25(13-18,16-23)22(28)26-21-14-27-9-7-19(21)8-10-27/h2-6,18-19,21H,7-17H2,1H3,(H,26,28)/t18?,21-,23-,24-,25?/m0/s1 |
| InChIKey | NBXHJKZISOMWMY-WBNZZRBASA-N |
| XLogP | 4.93 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|