C17H22N2O4S — CID 166909252
3-[3-(2-ethylbut-1-enylimino)-3-methoxyprop-1-en-2-yl]sulfinamoylbenzoic acid (PubChem CID 166909252) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 3-[3-(2-ethylbut-1-enylimino)-3-methoxyprop-1-en-2-yl]sulfinamoylbenzoic acid.
| Compound Name | 3-[3-(2-ethylbut-1-enylimino)-3-methoxyprop-1-en-2-yl]sulfinamoylbenzoic acid |
|---|---|
| PubChem CID | 166909252 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 3-[3-(2-ethylbut-1-enylimino)-3-methoxyprop-1-en-2-yl]sulfinamoylbenzoic acid |
| SMILES | C=C(NS(=O)c1cccc(C(=O)O)c1)/C(=N/C=C(CC)CC)OC |
| InChI | InChI=1S/C17H22N2O4S/c1-5-13(6-2)11-18-16(23-4)12(3)19-24(22)15-9-7-8-14(10-15)17(20)21/h7-11,19H,3,5-6H2,1-2,4H3,(H,20,21)/b18-16- |
| InChIKey | RLXBEQFNKWHEMS-VLGSPTGOSA-N |
| XLogP | 3.26 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|