C14H16N2 — CID 166911351
[6-[(3Z)-penta-1,3-dien-2-yl]-1H-indol-3-yl]methanamine (PubChem CID 166911351) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is [6-[(3Z)-penta-1,3-dien-2-yl]-1H-indol-3-yl]methanamine.
| Compound Name | [6-[(3Z)-penta-1,3-dien-2-yl]-1H-indol-3-yl]methanamine |
|---|---|
| PubChem CID | 166911351 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | [6-[(3Z)-penta-1,3-dien-2-yl]-1H-indol-3-yl]methanamine |
| SMILES | C=C(/C=C\C)c1ccc2c(CN)c[nH]c2c1 |
| InChI | InChI=1S/C14H16N2/c1-3-4-10(2)11-5-6-13-12(8-15)9-16-14(13)7-11/h3-7,9,16H,2,8,15H2,1H3/b4-3- |
| InChIKey | MQLDRZQHCZXFKB-ARJAWSKDSA-N |
| XLogP | 3.22 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|