C19H19F5NO4P — CID 166914064
methyl 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]acetate (PubChem CID 166914064) has the molecular formula C19H19F5NO4P and a molecular weight of 451.33 g/mol. Its IUPAC name is methyl 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]acetate.
| Compound Name | methyl 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]acetate |
|---|---|
| PubChem CID | 166914064 |
| Molecular Formula | C19H19F5NO4P |
| Molecular Weight | 451.33 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | methyl 2-[[(4-tert-butylphenoxy)-(2,3,4,5,6-pentafluorophenoxy)phosphanyl]amino]acetate |
| SMILES | COC(=O)CNP(Oc1ccc(C(C)(C)C)cc1)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H19F5NO4P/c1-19(2,3)10-5-7-11(8-6-10)28-30(25-9-12(26)27-4)29-18-16(23)14(21)13(20)15(22)17(18)24/h5-8,25H,9H2,1-4H3 |
| InChIKey | KQRLWZSDUHLINR-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.33 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|