About [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine
[10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine (PubChem CID 166919292) has the molecular formula C16H30N2
and a molecular weight of 250.43 g/mol. Its IUPAC name is [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine.
Molecular Properties
| Compound Name | [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine |
| PubChem CID | 166919292 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine |
| SMILES | CC1(CN)CC2CC(C1)C1CC(C)(CN)CCC21 |
| InChI | InChI=1S/C16H30N2/c1-15(9-17)4-3-13-11-5-12(14(13)8-15)7-16(2,6-11)10-18/h11-14H,3-10,17-18H2,1-2H3 |
| InChIKey | CTSXCHCLQADOBD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine?
The IUPAC name of [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine (CID 166919292) is [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine.
What is the SMILES notation for [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine?
The canonical SMILES for [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine is CC1(CN)CC2CC(C1)C1CC(C)(CN)CCC21.
What is the InChIKey of [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine?
The InChIKey is CTSXCHCLQADOBD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2/c1-15(9-17)4-3-13-11-5-12(14(13)8-15)7-16(2,6-11)10-18/h11-14H,3-10,17-18H2,1-2H3.
What are the key properties of [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine?
[10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine has a molecular weight of 250.43 g/mol, XLogP of 2.76, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [10-(aminomethyl)-4,10-dimethyl-4-tricyclo[6.3.1.02,7]dodecanyl]methanamine is sourced from PubChem (CID 166919292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).