C9H12N2 — CID 166920745
2,6-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine (PubChem CID 166920745) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 2,6-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine.
| Compound Name | 2,6-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine |
|---|---|
| PubChem CID | 166920745 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 2,6-dimethyl-1,3a-dihydropyrazolo[1,5-a]pyridine |
| SMILES | CC1=CN2NC(C)=CC2C=C1 |
| InChI | InChI=1S/C9H12N2/c1-7-3-4-9-5-8(2)10-11(9)6-7/h3-6,9-10H,1-2H3 |
| InChIKey | BCPBKAMYPDWIJS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |