C47H36N4 — CID 166923093
9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-14-phenyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20),18-octaene (PubChem CID 166923093) has the molecular formula C47H36N4 and a molecular weight of 656.83 g/mol. Its IUPAC name is 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-14-phenyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20),18-octaene.
| Compound Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-14-phenyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20),18-octaene |
|---|---|
| PubChem CID | 166923093 |
| Molecular Formula | C47H36N4 |
| Molecular Weight | 656.83 g/mol |
| Exact Mass | 656.29 |
| IUPAC Name | 9-(4,6-diphenyl-1,3,5-triazin-2-yl)-14-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-14-phenyl-9-azapentacyclo[11.7.0.02,10.03,8.015,20]icosa-1(13),2(10),3,5,7,11,15(20),18-octaene |
| SMILES | C=C/C(=C\C=C/C)C1(c2ccccc2)C2=C(C=CCC2)c2c1ccc1c2c2ccccc2n1-c1nc(-c2ccccc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C47H36N4/c1-3-5-23-34(4-2)47(35-24-13-8-14-25-35)38-28-17-15-26-36(38)42-39(47)30-31-41-43(42)37-27-16-18-29-40(37)51(41)46-49-44(32-19-9-6-10-20-32)48-45(50-46)33-21-11-7-12-22-33/h3-16,18-27,29-31H,2,17,28H2,1H3/b5-3-,34-23+ |
| InChIKey | VSCNPAFVYHXZDQ-NHKUQFQTSA-N |
| XLogP | 11.39 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.83 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|