About [cyano(nitroso)amino] hypoiodite
[cyano(nitroso)amino] hypoiodite (PubChem CID 166923687) has the molecular formula CIN3O2
and a molecular weight of 212.93 g/mol. Its IUPAC name is [cyano(nitroso)amino] hypoiodite.
Molecular Properties
| Compound Name | [cyano(nitroso)amino] hypoiodite |
| PubChem CID | 166923687 |
| Molecular Formula | CIN3O2 |
| Molecular Weight | 212.93 g/mol |
| Exact Mass | 212.90 |
| IUPAC Name | [cyano(nitroso)amino] hypoiodite |
| SMILES | N#CN(N=O)OI |
| InChI | InChI=1S/CIN3O2/c2-7-5(1-3)4-6 |
| InChIKey | WCOVJGPYTGEZHS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 65.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.93 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [cyano(nitroso)amino] hypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [cyano(nitroso)amino] hypoiodite?
The IUPAC name of [cyano(nitroso)amino] hypoiodite (CID 166923687) is [cyano(nitroso)amino] hypoiodite.
What is the SMILES notation for [cyano(nitroso)amino] hypoiodite?
The canonical SMILES for [cyano(nitroso)amino] hypoiodite is N#CN(N=O)OI.
What is the InChIKey of [cyano(nitroso)amino] hypoiodite?
The InChIKey is WCOVJGPYTGEZHS-UHFFFAOYSA-N. The full InChI is InChI=1S/CIN3O2/c2-7-5(1-3)4-6.
What are the key properties of [cyano(nitroso)amino] hypoiodite?
[cyano(nitroso)amino] hypoiodite has a molecular weight of 212.93 g/mol, XLogP of 0.73, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [cyano(nitroso)amino] hypoiodite is sourced from PubChem (CID 166923687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).