C18H29N — CID 166924073
[2-methyl-3-(10-methyl-4-tetracyclo[6.2.1.02,7.03,6]undecanyl)cyclobutyl]methanamine (PubChem CID 166924073) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is [2-methyl-3-(10-methyl-4-tetracyclo[6.2.1.02,7.03,6]undecanyl)cyclobutyl]methanamine.
| Compound Name | [2-methyl-3-(10-methyl-4-tetracyclo[6.2.1.02,7.03,6]undecanyl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 166924073 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | [2-methyl-3-(10-methyl-4-tetracyclo[6.2.1.02,7.03,6]undecanyl)cyclobutyl]methanamine |
| SMILES | CC1CC2CC1C1C2C2CC(C3CC(CN)C3C)C21 |
| InChI | InChI=1S/C18H29N/c1-8-3-10-4-12(8)18-16(10)15-6-14(17(15)18)13-5-11(7-19)9(13)2/h8-18H,3-7,19H2,1-2H3 |
| InChIKey | PAHGGLXIXHPIOB-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'} |
|---|