C31H36N6O2 — CID 166924343
(2E)-2-[benzyl(methyl)hydrazinylidene]-N-[9-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-yl]but-3-enamide (PubChem CID 166924343) has the molecular formula C31H36N6O2 and a molecular weight of 524.67 g/mol. Its IUPAC name is (2E)-2-[benzyl(methyl)hydrazinylidene]-N-[9-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-yl]but-3-enamide.
| Compound Name | (2E)-2-[benzyl(methyl)hydrazinylidene]-N-[9-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-yl]but-3-enamide |
|---|---|
| PubChem CID | 166924343 |
| Molecular Formula | C31H36N6O2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.29 |
| IUPAC Name | (2E)-2-[benzyl(methyl)hydrazinylidene]-N-[9-(7-oxa-2-azaspiro[3.5]nonan-2-yl)-5,6-dihydro-4H-imidazo[1,2-a][1]benzazepin-4-yl]but-3-enamide |
| SMILES | C=C/C(=N\N(C)Cc1ccccc1)C(=O)NC1CCc2ccc(N3CC4(CCOCC4)C3)cc2-n2ccnc21 |
| InChI | InChI=1S/C31H36N6O2/c1-3-26(34-35(2)20-23-7-5-4-6-8-23)30(38)33-27-12-10-24-9-11-25(19-28(24)37-16-15-32-29(27)37)36-21-31(22-36)13-17-39-18-14-31/h3-9,11,15-16,19,27H,1,10,12-14,17-18,20-22H2,2H3,(H,33,38)/b34-26+ |
| InChIKey | WMUUSDQEUFHTRV-JJNGWGCYSA-N |
| XLogP | 4.27 |
| TPSA | 74.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|