C28H29B3N6O3 — CID 156648084
CID 156648084 (PubChem CID 156648084) has the molecular formula C28H29B3N6O3 and a molecular weight of 530.02 g/mol.
| Compound Name | CID 156648084 |
|---|---|
| PubChem CID | 156648084 |
| Molecular Formula | C28H29B3N6O3 |
| Molecular Weight | 530.02 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])N1C(=O)C(NC(=O)c2n[nH]c(Cc3ccccc3)n2)CCc2ccc(N3CC4(CCOCC4)C3)cc21 |
| InChI | InChI=1S/C28H29B3N6O3/c29-28(30,31)37-22-15-20(36-16-27(17-36)10-12-40-13-11-27)8-6-19(22)7-9-21(26(37)39)32-25(38)24-33-23(34-35-24)14-18-4-2-1-3-5-18/h1-6,8,15,21H,7,9-14,16-17H2,(H,32,38)(H,33,34,35) |
| InChIKey | ZEVFFOSGQZLKNQ-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.02 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|