C12H16N2S — CID 166928411
5-tert-butyl-7-ethyl-[1,3]thiazolo[5,4-b]pyridine (PubChem CID 166928411) has the molecular formula C12H16N2S and a molecular weight of 220.34 g/mol. Its IUPAC name is 5-tert-butyl-7-ethyl-[1,3]thiazolo[5,4-b]pyridine.
| Compound Name | 5-tert-butyl-7-ethyl-[1,3]thiazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 166928411 |
| Molecular Formula | C12H16N2S |
| Molecular Weight | 220.34 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-tert-butyl-7-ethyl-[1,3]thiazolo[5,4-b]pyridine |
| SMILES | CCc1cc(C(C)(C)C)nc2scnc12 |
| InChI | InChI=1S/C12H16N2S/c1-5-8-6-9(12(2,3)4)14-11-10(8)13-7-15-11/h6-7H,5H2,1-4H3 |
| InChIKey | BFBSEXILJYQQNI-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |