C15H25NO — CID 176622096
2,4-ditert-butyl-6-ethoxypyridine (PubChem CID 176622096) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-ethoxypyridine.
| Compound Name | 2,4-ditert-butyl-6-ethoxypyridine |
|---|---|
| PubChem CID | 176622096 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | 2,4-ditert-butyl-6-ethoxypyridine |
| SMILES | CCOc1cc(C(C)(C)C)cc(C(C)(C)C)n1 |
| InChI | InChI=1S/C15H25NO/c1-8-17-13-10-11(14(2,3)4)9-12(16-13)15(5,6)7/h9-10H,8H2,1-7H3 |
| InChIKey | SHGIBFPEAXOQSH-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |