C23H20Cl2N8O4 — CID 166930205
2-[[(3S)-4-azidooxan-3-yl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrimido[5,4-c][1,8]naphthyridin-5-one (PubChem CID 166930205) has the molecular formula C23H20Cl2N8O4 and a molecular weight of 543.37 g/mol. Its IUPAC name is 2-[[(3S)-4-azidooxan-3-yl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrimido[5,4-c][1,8]naphthyridin-5-one.
| Compound Name | 2-[[(3S)-4-azidooxan-3-yl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrimido[5,4-c][1,8]naphthyridin-5-one |
|---|---|
| PubChem CID | 166930205 |
| Molecular Formula | C23H20Cl2N8O4 |
| Molecular Weight | 543.37 g/mol |
| Exact Mass | 542.10 |
| IUPAC Name | 2-[[(3S)-4-azidooxan-3-yl]amino]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrimido[5,4-c][1,8]naphthyridin-5-one |
| SMILES | COc1cc(OC)c(Cl)c(-n2c(=O)c3cnc(N[C@@H]4COCCC4N=[N+]=[N-])nc3c3cccnc32)c1Cl |
| InChI | InChI=1S/C23H20Cl2N8O4/c1-35-15-8-16(36-2)18(25)20(17(15)24)33-21-11(4-3-6-27-21)19-12(22(33)34)9-28-23(30-19)29-14-10-37-7-5-13(14)31-32-26/h3-4,6,8-9,13-14H,5,7,10H2,1-2H3,(H,28,29,30)/t13?,14-/m1/s1 |
| InChIKey | JCEGWTAKZDPCAM-ARLHGKGLSA-N |
| XLogP | 4.53 |
| TPSA | 149.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|