C20H19Cl2N7O3 — CID 139385336
N-[(3S,4S)-4-azidooxan-3-yl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-amine (PubChem CID 139385336) has the molecular formula C20H19Cl2N7O3 and a molecular weight of 476.32 g/mol. Its IUPAC name is N-[(3S,4S)-4-azidooxan-3-yl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-amine.
| Compound Name | N-[(3S,4S)-4-azidooxan-3-yl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-amine |
|---|---|
| PubChem CID | 139385336 |
| Molecular Formula | C20H19Cl2N7O3 |
| Molecular Weight | 476.32 g/mol |
| Exact Mass | 475.09 |
| IUPAC Name | N-[(3S,4S)-4-azidooxan-3-yl]-6-(2,6-dichloro-3,5-dimethoxyphenyl)pyrido[3,4-d]pyrimidin-2-amine |
| SMILES | COc1cc(OC)c(Cl)c(-c2cc3cnc(N[C@@H]4COCC[C@@H]4N=[N+]=[N-])nc3cn2)c1Cl |
| InChI | InChI=1S/C20H19Cl2N7O3/c1-30-15-6-16(31-2)19(22)17(18(15)21)12-5-10-7-25-20(26-13(10)8-24-12)27-14-9-32-4-3-11(14)28-29-23/h5-8,11,14H,3-4,9H2,1-2H3,(H,25,26,27)/t11-,14+/m0/s1 |
| InChIKey | IWIXUIWQARMMDO-SMDDNHRTSA-N |
| XLogP | 4.90 |
| TPSA | 127.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.32 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|