C19H29FN6O — CID 166940736
[3-[(Z)-1-amino-2-[amino-[[1-(2-aminoethyl)piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]methanol (PubChem CID 166940736) has the molecular formula C19H29FN6O and a molecular weight of 376.48 g/mol. Its IUPAC name is [3-[(Z)-1-amino-2-[amino-[[1-(2-aminoethyl)piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]methanol.
| Compound Name | [3-[(Z)-1-amino-2-[amino-[[1-(2-aminoethyl)piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 166940736 |
| Molecular Formula | C19H29FN6O |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.24 |
| IUPAC Name | [3-[(Z)-1-amino-2-[amino-[[1-(2-aminoethyl)piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]methanol |
| SMILES | NCCN1CCC(CN(N)/C=C(\N)c2c(CO)[nH]c3ccc(F)cc23)CC1 |
| InChI | InChI=1S/C19H29FN6O/c20-14-1-2-17-15(9-14)19(18(12-27)24-17)16(22)11-26(23)10-13-3-6-25(7-4-13)8-5-21/h1-2,9,11,13,24,27H,3-8,10,12,21-23H2/b16-11- |
| InChIKey | DOBAFHBEALDSFR-WJDWOHSUSA-N |
| XLogP | 0.90 |
| TPSA | 120.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|