C32H37FN6O2 — CID 166940705
1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(2-hydroxyphenyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone (PubChem CID 166940705) has the molecular formula C32H37FN6O2 and a molecular weight of 556.69 g/mol. Its IUPAC name is 1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(2-hydroxyphenyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone.
| Compound Name | 1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(2-hydroxyphenyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone |
|---|---|
| PubChem CID | 166940705 |
| Molecular Formula | C32H37FN6O2 |
| Molecular Weight | 556.69 g/mol |
| Exact Mass | 556.30 |
| IUPAC Name | 1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(2-hydroxyphenyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone |
| SMILES | CC(=O)c1[nH]c2ccc(F)cc2c1/C(N)=C/N(N)CC1CCN(CCNc2ccc(-c3ccccc3O)cc2)CC1 |
| InChI | InChI=1S/C32H37FN6O2/c1-21(40)32-31(27-18-24(33)8-11-29(27)37-32)28(34)20-39(35)19-22-12-15-38(16-13-22)17-14-36-25-9-6-23(7-10-25)26-4-2-3-5-30(26)41/h2-11,18,20,22,36-37,41H,12-17,19,34-35H2,1H3/b28-20- |
| InChIKey | GYMHWLKYUKIVOJ-RRAHZORUSA-N |
| XLogP | 5.14 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.69 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|