C30H40BrFN6O2 — CID 166940387
2-methylpropyl 3-[(Z)-1-amino-2-[amino-[[1-[2-[(3-bromophenyl)methylamino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indole-2-carboxylate (PubChem CID 166940387) has the molecular formula C30H40BrFN6O2 and a molecular weight of 615.59 g/mol. Its IUPAC name is 2-methylpropyl 3-[(Z)-1-amino-2-[amino-[[1-[2-[(3-bromophenyl)methylamino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indole-2-carboxylate.
| Compound Name | 2-methylpropyl 3-[(Z)-1-amino-2-[amino-[[1-[2-[(3-bromophenyl)methylamino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 166940387 |
| Molecular Formula | C30H40BrFN6O2 |
| Molecular Weight | 615.59 g/mol |
| Exact Mass | 614.24 |
| IUPAC Name | 2-methylpropyl 3-[(Z)-1-amino-2-[amino-[[1-[2-[(3-bromophenyl)methylamino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indole-2-carboxylate |
| SMILES | CC(C)COC(=O)c1[nH]c2ccc(F)cc2c1/C(N)=C/N(N)CC1CCN(CCNCc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C30H40BrFN6O2/c1-20(2)19-40-30(39)29-28(25-15-24(32)6-7-27(25)36-29)26(33)18-38(34)17-21-8-11-37(12-9-21)13-10-35-16-22-4-3-5-23(31)14-22/h3-7,14-15,18,20-21,35-36H,8-13,16-17,19,33-34H2,1-2H3/b26-18- |
| InChIKey | UEHMULJBMCKXDK-ITYLOYPMSA-N |
| XLogP | 4.82 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.59 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|