C30H39FN6O — CID 166940698
1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(cyclopropylmethyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone (PubChem CID 166940698) has the molecular formula C30H39FN6O and a molecular weight of 518.68 g/mol. Its IUPAC name is 1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(cyclopropylmethyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone.
| Compound Name | 1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(cyclopropylmethyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone |
|---|---|
| PubChem CID | 166940698 |
| Molecular Formula | C30H39FN6O |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.32 |
| IUPAC Name | 1-[3-[(Z)-1-amino-2-[amino-[[1-[2-[4-(cyclopropylmethyl)anilino]ethyl]piperidin-4-yl]methyl]amino]ethenyl]-5-fluoro-1H-indol-2-yl]ethanone |
| SMILES | CC(=O)c1[nH]c2ccc(F)cc2c1/C(N)=C/N(N)CC1CCN(CCNc2ccc(CC3CC3)cc2)CC1 |
| InChI | InChI=1S/C30H39FN6O/c1-20(38)30-29(26-17-24(31)6-9-28(26)35-30)27(32)19-37(33)18-23-10-13-36(14-11-23)15-12-34-25-7-4-22(5-8-25)16-21-2-3-21/h4-9,17,19,21,23,34-35H,2-3,10-16,18,32-33H2,1H3/b27-19- |
| InChIKey | OOQAERMIXOLEPR-DIBXZPPDSA-N |
| XLogP | 4.72 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|