C33H36F2N6O4S — CID 176537437
N-[2-[4-[[[(Z)-2-(2-acetyl-5-fluoro-1H-indol-3-yl)-2-aminoethenyl]-aminoamino]methyl]piperidin-1-yl]ethyl]-4-(2-fluoro-6-methoxyphenyl)benzenesulfonamide (PubChem CID 176537437) has the molecular formula C33H36F2N6O4S and a molecular weight of 650.75 g/mol. Its IUPAC name is N-[2-[4-[[[(Z)-2-(2-acetyl-5-fluoro-1H-indol-3-yl)-2-aminoethenyl]-aminoamino]methyl]piperidin-1-yl]ethyl]-4-(2-fluoro-6-methoxyphenyl)benzenesulfonamide.
| Compound Name | N-[2-[4-[[[(Z)-2-(2-acetyl-5-fluoro-1H-indol-3-yl)-2-aminoethenyl]-aminoamino]methyl]piperidin-1-yl]ethyl]-4-(2-fluoro-6-methoxyphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 176537437 |
| Molecular Formula | C33H36F2N6O4S |
| Molecular Weight | 650.75 g/mol |
| Exact Mass | 650.25 |
| IUPAC Name | N-[2-[4-[[[(Z)-2-(2-acetyl-5-fluoro-1H-indol-3-yl)-2-aminoethenyl]-aminoamino]methyl]piperidin-1-yl]ethyl]-4-(2-fluoro-6-methoxyphenyl)benzenesulfonamide |
| SMILES | COc1cccc(F)c1-c1ccc(S(=O)(=O)NCCN2CCC(CN(N)/C=C(\N)c3c(C(C)=O)[nH]c4c3=CC(F)=C=C=4)CC2)cc1 |
| InChI | InChI=1S/C33H36F2N6O4S/c1-21(42)33-32(26-18-24(34)8-11-29(26)39-33)28(36)20-41(37)19-22-12-15-40(16-13-22)17-14-38-46(43,44)25-9-6-23(7-10-25)31-27(35)4-3-5-30(31)45-2/h3-7,9-10,18,20,22,38-39H,12-17,19,36-37H2,1-2H3/b28-20- |
| InChIKey | WEFWTAMTXBBJGD-RRAHZORUSA-N |
| XLogP | 2.34 |
| TPSA | 146.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.75 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|