C12H27N2P — CID 16694824
1,3-ditert-butyl-4-methyl-1,3,2-diazaphosphinane (PubChem CID 16694824) has the molecular formula C12H27N2P and a molecular weight of 230.34 g/mol. Its IUPAC name is 1,3-ditert-butyl-4-methyl-1,3,2-diazaphosphinane.
| Compound Name | 1,3-ditert-butyl-4-methyl-1,3,2-diazaphosphinane |
|---|---|
| PubChem CID | 16694824 |
| Molecular Formula | C12H27N2P |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | 1,3-ditert-butyl-4-methyl-1,3,2-diazaphosphinane |
| SMILES | CC1CCN(C(C)(C)C)PN1C(C)(C)C |
| InChI | InChI=1S/C12H27N2P/c1-10-8-9-13(11(2,3)4)15-14(10)12(5,6)7/h10,15H,8-9H2,1-7H3 |
| InChIKey | IEFASYWDULKXDF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|