C29H36O7 — CID 166948526
2-[2-[2-[2-[2-[cyclohexa-1,5-dien-1-yl(diphenyl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 166948526) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[cyclohexa-1,5-dien-1-yl(diphenyl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[2-[cyclohexa-1,5-dien-1-yl(diphenyl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 166948526 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 2-[2-[2-[2-[2-[cyclohexa-1,5-dien-1-yl(diphenyl)methoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCCOCCOC(C1=CCCC=C1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H36O7/c30-28(31)24-35-21-20-33-17-16-32-18-19-34-22-23-36-29(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-2,4-8,10-15H,3,9,16-24H2,(H,30,31) |
| InChIKey | WHDPSQNZJXLJSX-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|