C13H27NO2 — CID 166950772
(E)-2-amino-6,6,8,8-tetramethylnon-4-ene-1,3-diol (PubChem CID 166950772) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is (E)-2-amino-6,6,8,8-tetramethylnon-4-ene-1,3-diol.
| Compound Name | (E)-2-amino-6,6,8,8-tetramethylnon-4-ene-1,3-diol |
|---|---|
| PubChem CID | 166950772 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | (E)-2-amino-6,6,8,8-tetramethylnon-4-ene-1,3-diol |
| SMILES | CC(C)(C)CC(C)(C)/C=C/C(O)C(N)CO |
| InChI | InChI=1S/C13H27NO2/c1-12(2,3)9-13(4,5)7-6-11(16)10(14)8-15/h6-7,10-11,15-16H,8-9,14H2,1-5H3/b7-6+ |
| InChIKey | VWIAQZMFZNFNHV-VOTSOKGWSA-N |
| XLogP | 1.69 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|