C22H24N6O3 — CID 166956321
1-[8-methoxy-6-[2-(phenoxymethylamino)hydrazinyl]-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]propan-1-one (PubChem CID 166956321) has the molecular formula C22H24N6O3 and a molecular weight of 420.47 g/mol. Its IUPAC name is 1-[8-methoxy-6-[2-(phenoxymethylamino)hydrazinyl]-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]propan-1-one.
| Compound Name | 1-[8-methoxy-6-[2-(phenoxymethylamino)hydrazinyl]-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]propan-1-one |
|---|---|
| PubChem CID | 166956321 |
| Molecular Formula | C22H24N6O3 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.19 |
| IUPAC Name | 1-[8-methoxy-6-[2-(phenoxymethylamino)hydrazinyl]-4H-imidazo[1,5-a][1,4]benzodiazepin-3-yl]propan-1-one |
| SMILES | CCC(=O)c1ncn2c1CN=C(NNNCOc1ccccc1)c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C22H24N6O3/c1-3-20(29)21-19-12-23-22(26-27-25-14-31-15-7-5-4-6-8-15)17-11-16(30-2)9-10-18(17)28(19)13-24-21/h4-11,13,25,27H,3,12,14H2,1-2H3,(H,23,26) |
| InChIKey | ILUIZAPIBMDTGW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|