C9H18O3S — CID 166956634
(2S,3S,4S,5S)-2,4-dimethyl-5-(1-sulfanylethoxymethyl)oxolan-3-ol (PubChem CID 166956634) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is (2S,3S,4S,5S)-2,4-dimethyl-5-(1-sulfanylethoxymethyl)oxolan-3-ol.
| Compound Name | (2S,3S,4S,5S)-2,4-dimethyl-5-(1-sulfanylethoxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 166956634 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | (2S,3S,4S,5S)-2,4-dimethyl-5-(1-sulfanylethoxymethyl)oxolan-3-ol |
| SMILES | CC(S)OC[C@H]1O[C@@H](C)[C@@H](O)[C@@H]1C |
| InChI | InChI=1S/C9H18O3S/c1-5-8(4-11-7(3)13)12-6(2)9(5)10/h5-10,13H,4H2,1-3H3/t5-,6+,7?,8-,9+/m1/s1 |
| InChIKey | AGVIZYCXPYHJLU-OVVPSANESA-N |
| XLogP | 1.06 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|