About Lead triacetate
Lead triacetate (PubChem CID 16695854) has the molecular formula C6H9O6Pb
and a molecular weight of 384.33 g/mol.
Molecular Properties
| Compound Name | Lead triacetate |
| PubChem CID | 16695854 |
| Molecular Formula | C6H9O6Pb |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | — |
| SMILES | CC(=O)O[Pb](OC(C)=O)OC(C)=O |
| InChI | InChI=1S/3C2H4O2.Pb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3 |
| InChIKey | NYHDARUOKPETFK-UHFFFAOYSA-K |
| XLogP | -0.34 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze Lead triacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Lead triacetate?
The IUPAC name of Lead triacetate (CID 16695854) is not available.
What is the SMILES notation for Lead triacetate?
The canonical SMILES for Lead triacetate is CC(=O)O[Pb](OC(C)=O)OC(C)=O.
What is the InChIKey of Lead triacetate?
The InChIKey is NYHDARUOKPETFK-UHFFFAOYSA-K. The full InChI is InChI=1S/3C2H4O2.Pb/c3*1-2(3)4;/h3*1H3,(H,3,4);/q;;;+3/p-3.
What are the key properties of Lead triacetate?
Lead triacetate has a molecular weight of 384.33 g/mol, XLogP of -0.34, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Lead triacetate is sourced from PubChem (CID 16695854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).