C41H30N4S2 — CID 166960247
N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hexa-1,3,5-trien-3-yl]-N-[4-(4,5-dihydro-1,3-benzothiazol-2-yl)phenyl]-4-isoquinolin-3-ylaniline (PubChem CID 166960247) has the molecular formula C41H30N4S2 and a molecular weight of 642.85 g/mol. Its IUPAC name is N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hexa-1,3,5-trien-3-yl]-N-[4-(4,5-dihydro-1,3-benzothiazol-2-yl)phenyl]-4-isoquinolin-3-ylaniline.
| Compound Name | N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hexa-1,3,5-trien-3-yl]-N-[4-(4,5-dihydro-1,3-benzothiazol-2-yl)phenyl]-4-isoquinolin-3-ylaniline |
|---|---|
| PubChem CID | 166960247 |
| Molecular Formula | C41H30N4S2 |
| Molecular Weight | 642.85 g/mol |
| Exact Mass | 642.19 |
| IUPAC Name | N-[(3E,5E)-6-(1,3-benzothiazol-2-yl)hexa-1,3,5-trien-3-yl]-N-[4-(4,5-dihydro-1,3-benzothiazol-2-yl)phenyl]-4-isoquinolin-3-ylaniline |
| SMILES | C=C/C(=C\C=C\c1nc2ccccc2s1)N(c1ccc(-c2cc3ccccc3cn2)cc1)c1ccc(-c2nc3c(s2)C=CCC3)cc1 |
| InChI | InChI=1S/C41H30N4S2/c1-2-32(12-9-17-40-43-35-13-5-7-15-38(35)46-40)45(34-24-20-29(21-25-34)41-44-36-14-6-8-16-39(36)47-41)33-22-18-28(19-23-33)37-26-30-10-3-4-11-31(30)27-42-37/h2-5,7-13,15-27H,1,6,14H2/b17-9+,32-12+ |
| InChIKey | PBWMHUKRXLBIQQ-ZWHIDPDRSA-N |
| XLogP | 11.52 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.85 |
| LogP ≤ 5 | 11.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|