C10H19NO2 — CID 166963780
2-[(2R,5S,6R)-6-ethyl-5-methyloxan-2-yl]acetamide (PubChem CID 166963780) has the molecular formula C10H19NO2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-[(2R,5S,6R)-6-ethyl-5-methyloxan-2-yl]acetamide.
| Compound Name | 2-[(2R,5S,6R)-6-ethyl-5-methyloxan-2-yl]acetamide |
|---|---|
| PubChem CID | 166963780 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 2-[(2R,5S,6R)-6-ethyl-5-methyloxan-2-yl]acetamide |
| SMILES | CC[C@H]1O[C@@H](CC(N)=O)CC[C@@H]1C |
| InChI | InChI=1S/C10H19NO2/c1-3-9-7(2)4-5-8(13-9)6-10(11)12/h7-9H,3-6H2,1-2H3,(H2,11,12)/t7-,8+,9+/m0/s1 |
| InChIKey | SPUPHWPXRLPPQF-DJLDLDEBSA-N |
| XLogP | 1.46 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |