C13H25NO7 — CID 166969402
methyl 3-methyl-2-[[(2R,3S,5S)-2,3,5,6-tetrahydroxyhexanoyl]amino]pentanoate (PubChem CID 166969402) has the molecular formula C13H25NO7 and a molecular weight of 307.34 g/mol. Its IUPAC name is methyl 3-methyl-2-[[(2R,3S,5S)-2,3,5,6-tetrahydroxyhexanoyl]amino]pentanoate.
| Compound Name | methyl 3-methyl-2-[[(2R,3S,5S)-2,3,5,6-tetrahydroxyhexanoyl]amino]pentanoate |
|---|---|
| PubChem CID | 166969402 |
| Molecular Formula | C13H25NO7 |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.16 |
| IUPAC Name | methyl 3-methyl-2-[[(2R,3S,5S)-2,3,5,6-tetrahydroxyhexanoyl]amino]pentanoate |
| SMILES | CCC(C)C(NC(=O)[C@H](O)[C@@H](O)C[C@H](O)CO)C(=O)OC |
| InChI | InChI=1S/C13H25NO7/c1-4-7(2)10(13(20)21-3)14-12(19)11(18)9(17)5-8(16)6-15/h7-11,15-18H,4-6H2,1-3H3,(H,14,19)/t7?,8-,9-,10?,11+/m0/s1 |
| InChIKey | HTZPSQFDERCJQW-RIKJVJJSSA-N |
| XLogP | -1.84 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |