C28H36N4O2 — CID 166971363
8-[4-formyl-3-[2-(methylamino)ethyl]phenyl]-2-methylimino-N,N-dipropyl-1,3-dihydro-1-benzazepine-4-carboxamide (PubChem CID 166971363) has the molecular formula C28H36N4O2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 8-[4-formyl-3-[2-(methylamino)ethyl]phenyl]-2-methylimino-N,N-dipropyl-1,3-dihydro-1-benzazepine-4-carboxamide.
| Compound Name | 8-[4-formyl-3-[2-(methylamino)ethyl]phenyl]-2-methylimino-N,N-dipropyl-1,3-dihydro-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 166971363 |
| Molecular Formula | C28H36N4O2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.28 |
| IUPAC Name | 8-[4-formyl-3-[2-(methylamino)ethyl]phenyl]-2-methylimino-N,N-dipropyl-1,3-dihydro-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(-c3ccc(C=O)c(CCNC)c3)cc2N/C(=N/C)C1 |
| InChI | InChI=1S/C28H36N4O2/c1-5-13-32(14-6-2)28(34)25-16-23-9-7-21(17-26(23)31-27(18-25)30-4)20-8-10-24(19-33)22(15-20)11-12-29-3/h7-10,15-17,19,29H,5-6,11-14,18H2,1-4H3,(H,30,31) |
| InChIKey | HTYZEDKYNYRRAA-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|