C25H31N5O4 — CID 131969079
2-[4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetic acid (PubChem CID 131969079) has the molecular formula C25H31N5O4 and a molecular weight of 465.55 g/mol. Its IUPAC name is 2-[4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetic acid.
| Compound Name | 2-[4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetic acid |
|---|---|
| PubChem CID | 131969079 |
| Molecular Formula | C25H31N5O4 |
| Molecular Weight | 465.55 g/mol |
| Exact Mass | 465.24 |
| IUPAC Name | 2-[4-[2-(aminodiazenyl)-4-[3-hydroxypropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetic acid |
| SMILES | CCCN(CCCO)C(=O)C1=Cc2ccc(-c3ccc(CC(=O)O)cc3)cc2NC(N=NN)C1 |
| InChI | InChI=1S/C25H31N5O4/c1-2-10-30(11-3-12-31)25(34)21-14-20-9-8-19(15-22(20)27-23(16-21)28-29-26)18-6-4-17(5-7-18)13-24(32)33/h4-9,14-15,23,27,31H,2-3,10-13,16H2,1H3,(H2,26,28)(H,32,33) |
| InChIKey | PRMYHGBHOZUNRU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 140.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.55 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|