C29H38N6O3 — CID 131968965
cyclopropylmethyl 2-[4-[2-(aminodiazenyl)-4-[3-aminopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate (PubChem CID 131968965) has the molecular formula C29H38N6O3 and a molecular weight of 518.66 g/mol. Its IUPAC name is cyclopropylmethyl 2-[4-[2-(aminodiazenyl)-4-[3-aminopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate.
| Compound Name | cyclopropylmethyl 2-[4-[2-(aminodiazenyl)-4-[3-aminopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate |
|---|---|
| PubChem CID | 131968965 |
| Molecular Formula | C29H38N6O3 |
| Molecular Weight | 518.66 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | cyclopropylmethyl 2-[4-[2-(aminodiazenyl)-4-[3-aminopropyl(propyl)carbamoyl]-2,3-dihydro-1H-1-benzazepin-8-yl]phenyl]acetate |
| SMILES | CCCN(CCCN)C(=O)C1=Cc2ccc(-c3ccc(CC(=O)OCC4CC4)cc3)cc2NC(N=NN)C1 |
| InChI | InChI=1S/C29H38N6O3/c1-2-13-35(14-3-12-30)29(37)25-16-24-11-10-23(17-26(24)32-27(18-25)33-34-31)22-8-6-20(7-9-22)15-28(36)38-19-21-4-5-21/h6-11,16-17,21,27,32H,2-5,12-15,18-19,30H2,1H3,(H2,31,33) |
| InChIKey | AJDICTFYRDYIOV-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 135.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.66 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|