C24H30N6O — CID 129058503
2-(aminodiazenyl)-8-(3-cyanocyclohexa-1,3-dien-1-yl)-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide (PubChem CID 129058503) has the molecular formula C24H30N6O and a molecular weight of 418.55 g/mol. Its IUPAC name is 2-(aminodiazenyl)-8-(3-cyanocyclohexa-1,3-dien-1-yl)-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide.
| Compound Name | 2-(aminodiazenyl)-8-(3-cyanocyclohexa-1,3-dien-1-yl)-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 129058503 |
| Molecular Formula | C24H30N6O |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 2-(aminodiazenyl)-8-(3-cyanocyclohexa-1,3-dien-1-yl)-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(C3=CC(C#N)=CCC3)cc2NC(N=NN)C1 |
| InChI | InChI=1S/C24H30N6O/c1-3-10-30(11-4-2)24(31)21-13-20-9-8-19(18-7-5-6-17(12-18)16-25)14-22(20)27-23(15-21)28-29-26/h6,8-9,12-14,23,27H,3-5,7,10-11,15H2,1-2H3,(H2,26,28) |
| InChIKey | HKYZJZWYIPMZKQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|