C24H31N5O2 — CID 131969061
2-(aminodiazenyl)-8-phenylmethoxy-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide (PubChem CID 131969061) has the molecular formula C24H31N5O2 and a molecular weight of 421.55 g/mol. Its IUPAC name is 2-(aminodiazenyl)-8-phenylmethoxy-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide.
| Compound Name | 2-(aminodiazenyl)-8-phenylmethoxy-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 131969061 |
| Molecular Formula | C24H31N5O2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | 2-(aminodiazenyl)-8-phenylmethoxy-N,N-dipropyl-2,3-dihydro-1H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=Cc2ccc(OCc3ccccc3)cc2NC(N=NN)C1 |
| InChI | InChI=1S/C24H31N5O2/c1-3-12-29(13-4-2)24(30)20-14-19-10-11-21(31-17-18-8-6-5-7-9-18)16-22(19)26-23(15-20)27-28-25/h5-11,14,16,23,26H,3-4,12-13,15,17H2,1-2H3,(H2,25,27) |
| InChIKey | REWMMKWFICORRF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 92.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|