C29H40N6O4 — CID 131969004
butyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3,9,9a-tetrahydro-1H-1-benzazepin-8-yl]phenyl]acetate (PubChem CID 131969004) has the molecular formula C29H40N6O4 and a molecular weight of 536.68 g/mol. Its IUPAC name is butyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3,9,9a-tetrahydro-1H-1-benzazepin-8-yl]phenyl]acetate.
| Compound Name | butyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3,9,9a-tetrahydro-1H-1-benzazepin-8-yl]phenyl]acetate |
|---|---|
| PubChem CID | 131969004 |
| Molecular Formula | C29H40N6O4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | butyl 2-[4-[2-(aminodiazenyl)-4-[3-nitrosopropyl(propyl)carbamoyl]-2,3,9,9a-tetrahydro-1H-1-benzazepin-8-yl]phenyl]acetate |
| SMILES | CCCCOC(=O)Cc1ccc(C2=CC=C3C=C(C(=O)N(CCC)CCCN=O)CC(N=NN)NC3C2)cc1 |
| InChI | InChI=1S/C29H40N6O4/c1-3-5-16-39-28(36)17-21-7-9-22(10-8-21)23-11-12-24-18-25(20-27(33-34-30)32-26(24)19-23)29(37)35(14-4-2)15-6-13-31-38/h7-12,18,26-27,32H,3-6,13-17,19-20H2,1-2H3,(H2,30,33) |
| InChIKey | KGTOLQIZYACTCJ-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 138.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|