C28H36N8O4 — CID 129058401
2-(aminodiazenyl)-N-(3-nitrosopropyl)-8-[4-[(3R)-3-nitrosopyrrolidine-1-carbonyl]phenyl]-N-propyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide (PubChem CID 129058401) has the molecular formula C28H36N8O4 and a molecular weight of 548.65 g/mol. Its IUPAC name is 2-(aminodiazenyl)-N-(3-nitrosopropyl)-8-[4-[(3R)-3-nitrosopyrrolidine-1-carbonyl]phenyl]-N-propyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide.
| Compound Name | 2-(aminodiazenyl)-N-(3-nitrosopropyl)-8-[4-[(3R)-3-nitrosopyrrolidine-1-carbonyl]phenyl]-N-propyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 129058401 |
| Molecular Formula | C28H36N8O4 |
| Molecular Weight | 548.65 g/mol |
| Exact Mass | 548.29 |
| IUPAC Name | 2-(aminodiazenyl)-N-(3-nitrosopropyl)-8-[4-[(3R)-3-nitrosopyrrolidine-1-carbonyl]phenyl]-N-propyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCCN=O)C(=O)C1=CC2=CC=C(c3ccc(C(=O)N4CC[C@@H](N=O)C4)cc3)CC2NC(N=NN)C1 |
| InChI | InChI=1S/C28H36N8O4/c1-2-12-35(13-3-11-30-39)28(38)23-15-22-9-8-21(16-25(22)31-26(17-23)32-34-29)19-4-6-20(7-5-19)27(37)36-14-10-24(18-36)33-40/h4-9,15,24-26,31H,2-3,10-14,16-18H2,1H3,(H2,29,32)/t24-,25?,26?/m1/s1 |
| InChIKey | UWUODYWEHZIZKX-JDSVYEKJSA-N |
| XLogP | 3.72 |
| TPSA | 162.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.65 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|