C23H33N7O2 — CID 131969207
2-(aminodiazenyl)-8-[5-(nitrosomethyl)-1,2-dihydropyridin-3-yl]-N,N-dipropyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide (PubChem CID 131969207) has the molecular formula C23H33N7O2 and a molecular weight of 439.56 g/mol. Its IUPAC name is 2-(aminodiazenyl)-8-[5-(nitrosomethyl)-1,2-dihydropyridin-3-yl]-N,N-dipropyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide.
| Compound Name | 2-(aminodiazenyl)-8-[5-(nitrosomethyl)-1,2-dihydropyridin-3-yl]-N,N-dipropyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide |
|---|---|
| PubChem CID | 131969207 |
| Molecular Formula | C23H33N7O2 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-(aminodiazenyl)-8-[5-(nitrosomethyl)-1,2-dihydropyridin-3-yl]-N,N-dipropyl-2,3,9,9a-tetrahydro-1H-1-benzazepine-4-carboxamide |
| SMILES | CCCN(CCC)C(=O)C1=CC2=CC=C(C3=CC(CN=O)=CNC3)CC2NC(N=NN)C1 |
| InChI | InChI=1S/C23H33N7O2/c1-3-7-30(8-4-2)23(31)19-10-18-6-5-17(11-21(18)27-22(12-19)28-29-24)20-9-16(14-26-32)13-25-15-20/h5-6,9-10,13,21-22,25,27H,3-4,7-8,11-12,14-15H2,1-2H3,(H2,24,28) |
| InChIKey | SBCIZDYGWUQNLO-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 124.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|