C19H23N3O2 — CID 166973032
(4E)-1-butyl-4-[(1,2-dimethylindol-3-yl)methylidene]-2-methylpyrazolidine-3,5-dione (PubChem CID 166973032) has the molecular formula C19H23N3O2 and a molecular weight of 325.41 g/mol. Its IUPAC name is (4E)-1-butyl-4-[(1,2-dimethylindol-3-yl)methylidene]-2-methylpyrazolidine-3,5-dione.
| Compound Name | (4E)-1-butyl-4-[(1,2-dimethylindol-3-yl)methylidene]-2-methylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 166973032 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | (4E)-1-butyl-4-[(1,2-dimethylindol-3-yl)methylidene]-2-methylpyrazolidine-3,5-dione |
| SMILES | CCCCN1C(=O)/C(=C/c2c(C)n(C)c3ccccc23)C(=O)N1C |
| InChI | InChI=1S/C19H23N3O2/c1-5-6-11-22-19(24)16(18(23)21(22)4)12-15-13(2)20(3)17-10-8-7-9-14(15)17/h7-10,12H,5-6,11H2,1-4H3/b16-12+ |
| InChIKey | YYIUQTHXBPKXKH-FOWTUZBSSA-N |
| XLogP | 2.89 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_five_het_D(46)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|