C40H11F25N2 — CID 166974338
5-phenyl-1-N-(2,3,5,6-tetrafluoro-4-methylphenyl)-1-N,3-N,3-N-tris[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzene-1,3-diamine (PubChem CID 166974338) has the molecular formula C40H11F25N2 and a molecular weight of 994.49 g/mol. Its IUPAC name is 5-phenyl-1-N-(2,3,5,6-tetrafluoro-4-methylphenyl)-1-N,3-N,3-N-tris[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzene-1,3-diamine.
| Compound Name | 5-phenyl-1-N-(2,3,5,6-tetrafluoro-4-methylphenyl)-1-N,3-N,3-N-tris[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzene-1,3-diamine |
|---|---|
| PubChem CID | 166974338 |
| Molecular Formula | C40H11F25N2 |
| Molecular Weight | 994.49 g/mol |
| Exact Mass | 994.05 |
| IUPAC Name | 5-phenyl-1-N-(2,3,5,6-tetrafluoro-4-methylphenyl)-1-N,3-N,3-N-tris[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]benzene-1,3-diamine |
| SMILES | Cc1c(F)c(F)c(N(c2cc(-c3ccccc3)cc(N(c3c(F)c(F)c(C(F)(F)F)c(F)c3F)c3c(F)c(F)c(C(F)(F)F)c(F)c3F)c2)c2c(F)c(F)c(C(F)(F)F)c(F)c2F)c(F)c1F |
| InChI | InChI=1S/C40H11F25N2/c1-10-18(41)26(49)34(27(50)19(10)42)66(35-28(51)20(43)15(38(57,58)59)21(44)29(35)52)13-7-12(11-5-3-2-4-6-11)8-14(9-13)67(36-30(53)22(45)16(39(60,61)62)23(46)31(36)54)37-32(55)24(47)17(40(63,64)65)25(48)33(37)56/h2-9H,1H3 |
| InChIKey | HCKIEPCJWCTMKU-UHFFFAOYSA-N |
| XLogP | 15.88 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 994.49 |
| LogP ≤ 5 | 15.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|