C43H6F27N — CID 166974287
N,N-bis[3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline (PubChem CID 166974287) has the molecular formula C43H6F27N and a molecular weight of 1049.47 g/mol. Its IUPAC name is N,N-bis[3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline.
| Compound Name | N,N-bis[3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 166974287 |
| Molecular Formula | C43H6F27N |
| Molecular Weight | 1049.47 g/mol |
| Exact Mass | 1049.01 |
| IUPAC Name | N,N-bis[3,5-bis(2,3,4,5,6-pentafluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(trifluoromethyl)aniline |
| SMILES | Fc1c(F)c(F)c(-c2cc(-c3c(F)c(F)c(F)c(F)c3F)cc(N(c3cc(-c4c(F)c(F)c(F)c(F)c4F)cc(-c4c(F)c(F)c(F)c(F)c4F)c3)c3c(F)c(F)c(C(F)(F)F)c(F)c3F)c2)c(F)c1F |
| InChI | InChI=1S/C43H6F27N/c44-18-13(19(45)29(55)36(62)28(18)54)7-1-8(14-20(46)30(56)37(63)31(57)21(14)47)4-11(3-7)71(42-40(66)26(52)17(43(68,69)70)27(53)41(42)67)12-5-9(15-22(48)32(58)38(64)33(59)23(15)49)2-10(6-12)16-24(50)34(60)39(65)35(61)25(16)51/h1-6H |
| InChIKey | XXCCFTPNHBIDMI-UHFFFAOYSA-N |
| XLogP | 16.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1049.47 |
| LogP ≤ 5 | 16.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|