C42H9F22N — CID 166974188
N-[3,5-bis(2,3-difluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline (PubChem CID 166974188) has the molecular formula C42H9F22N and a molecular weight of 945.50 g/mol. Its IUPAC name is N-[3,5-bis(2,3-difluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline.
| Compound Name | N-[3,5-bis(2,3-difluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline |
|---|---|
| PubChem CID | 166974188 |
| Molecular Formula | C42H9F22N |
| Molecular Weight | 945.50 g/mol |
| Exact Mass | 945.04 |
| IUPAC Name | N-[3,5-bis(2,3-difluorophenyl)phenyl]-2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)-N-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]aniline |
| SMILES | Fc1cccc(-c2cc(-c3cccc(F)c3F)cc(N(c3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c3c(F)c(F)c(-c4c(F)c(F)c(F)c(F)c4F)c(F)c3F)c2)c1F |
| InChI | InChI=1S/C42H9F22N/c43-15-5-1-3-13(21(15)45)10-7-11(14-4-2-6-16(44)22(14)46)9-12(8-10)65(41-37(61)27(51)19(28(52)38(41)62)17-23(47)31(55)35(59)32(56)24(17)48)42-39(63)29(53)20(30(54)40(42)64)18-25(49)33(57)36(60)34(58)26(18)50/h1-9H |
| InChIKey | VEVAUADPYBVJQY-UHFFFAOYSA-N |
| XLogP | 14.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 945.50 |
| LogP ≤ 5 | 14.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|