C12H2F24INO4S2 — CID 166980155
1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-iodo-N-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexylsulfonyl)hexane-1-sulfonamide (PubChem CID 166980155) has the molecular formula C12H2F24INO4S2 and a molecular weight of 871.14 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-iodo-N-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexylsulfonyl)hexane-1-sulfonamide.
| Compound Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-iodo-N-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexylsulfonyl)hexane-1-sulfonamide |
|---|---|
| PubChem CID | 166980155 |
| Molecular Formula | C12H2F24INO4S2 |
| Molecular Weight | 871.14 g/mol |
| Exact Mass | 870.81 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5,6,6,6-tridecafluoro-N-iodo-N-(1,1,2,2,3,3,4,4,5,5,6-undecafluorohexylsulfonyl)hexane-1-sulfonamide |
| SMILES | O=S(=O)(N(I)S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CF |
| InChI | InChI=1S/C12H2F24INO4S2/c13-1-2(14,15)3(16,17)4(18,19)8(26,27)11(33,34)43(39,40)38(37)44(41,42)12(35,36)9(28,29)6(22,23)5(20,21)7(24,25)10(30,31)32/h1H2 |
| InChIKey | RFPLVZKJVSLQQC-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 871.14 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|