About CID 16698052
CID 16698052 (PubChem CID 16698052) has the molecular formula C13H13GeS
and a molecular weight of 273.92 g/mol.
Molecular Properties
| Compound Name | CID 16698052 |
| PubChem CID | 16698052 |
| Molecular Formula | C13H13GeS |
| Molecular Weight | 273.92 g/mol |
| Exact Mass | 274.99 |
| IUPAC Name | — |
| SMILES | CS[Ge](c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C13H13GeS/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3 |
| InChIKey | FSLCGVBFONEWLY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.92 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 16698052 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 16698052?
The IUPAC name of CID 16698052 (CID 16698052) is not available.
What is the SMILES notation for CID 16698052?
The canonical SMILES for CID 16698052 is CS[Ge](c1ccccc1)c1ccccc1.
What is the InChIKey of CID 16698052?
The InChIKey is FSLCGVBFONEWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13GeS/c1-15-14(12-8-4-2-5-9-12)13-10-6-3-7-11-13/h2-11H,1H3.
What are the key properties of CID 16698052?
CID 16698052 has a molecular weight of 273.92 g/mol, XLogP of 2.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 16698052 is sourced from PubChem (CID 16698052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).