C23H23F3N2O2 — CID 166981084
4-[[2-[(Z,2E)-2-prop-2-enylidenehex-3-enoyl]-2-azaspiro[3.3]heptan-6-yl]oxy]-2-(trifluoromethyl)benzonitrile (PubChem CID 166981084) has the molecular formula C23H23F3N2O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 4-[[2-[(Z,2E)-2-prop-2-enylidenehex-3-enoyl]-2-azaspiro[3.3]heptan-6-yl]oxy]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[[2-[(Z,2E)-2-prop-2-enylidenehex-3-enoyl]-2-azaspiro[3.3]heptan-6-yl]oxy]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 166981084 |
| Molecular Formula | C23H23F3N2O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 4-[[2-[(Z,2E)-2-prop-2-enylidenehex-3-enoyl]-2-azaspiro[3.3]heptan-6-yl]oxy]-2-(trifluoromethyl)benzonitrile |
| SMILES | C=C/C=C(\C=C/CC)C(=O)N1CC2(CC(Oc3ccc(C#N)c(C(F)(F)F)c3)C2)C1 |
| InChI | InChI=1S/C23H23F3N2O2/c1-3-5-7-16(6-4-2)21(29)28-14-22(15-28)11-19(12-22)30-18-9-8-17(13-27)20(10-18)23(24,25)26/h4-10,19H,2-3,11-12,14-15H2,1H3/b7-5-,16-6+ |
| InChIKey | DHHSAWKQJGCCLP-NHJLLJAQSA-N |
| XLogP | 5.03 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|