C38H41NO — CID 166989842
3-[(3R)-3-cyclohexa-1,5-dien-1-yl-5-(5-methylcyclohex-3-en-1-yl)cyclohexa-1,5-dien-1-yl]-1-ethenyl-2-[(Z)-prop-1-enyl]-1,2,5b,9a-tetrahydro-[1]benzofuro[2,3-e]indole (PubChem CID 166989842) has the molecular formula C38H41NO and a molecular weight of 527.75 g/mol. Its IUPAC name is 3-[(3R)-3-cyclohexa-1,5-dien-1-yl-5-(5-methylcyclohex-3-en-1-yl)cyclohexa-1,5-dien-1-yl]-1-ethenyl-2-[(Z)-prop-1-enyl]-1,2,5b,9a-tetrahydro-[1]benzofuro[2,3-e]indole.
| Compound Name | 3-[(3R)-3-cyclohexa-1,5-dien-1-yl-5-(5-methylcyclohex-3-en-1-yl)cyclohexa-1,5-dien-1-yl]-1-ethenyl-2-[(Z)-prop-1-enyl]-1,2,5b,9a-tetrahydro-[1]benzofuro[2,3-e]indole |
|---|---|
| PubChem CID | 166989842 |
| Molecular Formula | C38H41NO |
| Molecular Weight | 527.75 g/mol |
| Exact Mass | 527.32 |
| IUPAC Name | 3-[(3R)-3-cyclohexa-1,5-dien-1-yl-5-(5-methylcyclohex-3-en-1-yl)cyclohexa-1,5-dien-1-yl]-1-ethenyl-2-[(Z)-prop-1-enyl]-1,2,5b,9a-tetrahydro-[1]benzofuro[2,3-e]indole |
| SMILES | C=CC1c2c(ccc3c2OC2C=CC=CC32)N(C2=C[C@H](C3=CCCC=C3)CC(C3CC=CC(C)C3)=C2)C1/C=C\C |
| InChI | InChI=1S/C38H41NO/c1-4-12-34-31(5-2)37-35(20-19-33-32-17-9-10-18-36(32)40-38(33)37)39(34)30-23-28(26-14-7-6-8-15-26)22-29(24-30)27-16-11-13-25(3)21-27/h4-5,7,9-15,17-20,23-25,27-28,31-32,34,36H,2,6,8,16,21-22H2,1,3H3/b12-4-/t25?,27?,28-,31?,32?,34?,36?/m1/s1 |
| InChIKey | LDJILLYPSSRRRS-MQTKESSMSA-N |
| XLogP | 9.40 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.75 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|