C22H31AlSi2 — CID 16699411
(15-ethyl-8-trimethylsilyl-15-aluminatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-1-yl)-trimethylsilane (PubChem CID 16699411) has the molecular formula C22H31AlSi2 and a molecular weight of 378.64 g/mol. Its IUPAC name is (15-ethyl-8-trimethylsilyl-15-aluminatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-1-yl)-trimethylsilane.
| Compound Name | (15-ethyl-8-trimethylsilyl-15-aluminatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-1-yl)-trimethylsilane |
|---|---|
| PubChem CID | 16699411 |
| Molecular Formula | C22H31AlSi2 |
| Molecular Weight | 378.64 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | (15-ethyl-8-trimethylsilyl-15-aluminatetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaen-1-yl)-trimethylsilane |
| SMILES | CC[Al]1C2([Si](C)(C)C)c3ccccc3C1([Si](C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C20H26Si2.C2H5.Al/c1-21(2,3)19-15-11-7-9-13-17(15)20(22(4,5)6)18-14-10-8-12-16(18)19;1-2;/h7-14H,1-6H3;1H2,2H3; |
| InChIKey | GTQJQPLRLUNNNY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.64 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|