C17H26Se — CID 13212210
2-butylselanyl-1,1,3,3-tetramethyl-2H-indene (PubChem CID 13212210) has the molecular formula C17H26Se and a molecular weight of 309.36 g/mol. Its IUPAC name is 2-butylselanyl-1,1,3,3-tetramethyl-2H-indene.
| Compound Name | 2-butylselanyl-1,1,3,3-tetramethyl-2H-indene |
|---|---|
| PubChem CID | 13212210 |
| Molecular Formula | C17H26Se |
| Molecular Weight | 309.36 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | 2-butylselanyl-1,1,3,3-tetramethyl-2H-indene |
| SMILES | CCCC[Se]C1C(C)(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C17H26Se/c1-6-7-12-18-15-16(2,3)13-10-8-9-11-14(13)17(15,4)5/h8-11,15H,6-7,12H2,1-5H3 |
| InChIKey | NSOBQVIGWODZDJ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.36 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|