C14H22N+ — CID 59449433
2,3,3-trimethyl-1-propyl-1,2-dihydroindol-1-ium (PubChem CID 59449433) has the molecular formula C14H22N+ and a molecular weight of 204.34 g/mol. Its IUPAC name is 2,3,3-trimethyl-1-propyl-1,2-dihydroindol-1-ium.
| Compound Name | 2,3,3-trimethyl-1-propyl-1,2-dihydroindol-1-ium |
|---|---|
| PubChem CID | 59449433 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | 2,3,3-trimethyl-1-propyl-1,2-dihydroindol-1-ium |
| SMILES | CCC[NH+]1c2ccccc2C(C)(C)C1C |
| InChI | InChI=1S/C14H21N/c1-5-10-15-11(2)14(3,4)12-8-6-7-9-13(12)15/h6-9,11H,5,10H2,1-4H3/p+1 |
| InChIKey | UOUGJZPSXIGOIY-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |