C22H19ClFN5O2S — CID 167004969
(E)-4-[(3S)-8-chloro-5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]but-3-en-1-one (PubChem CID 167004969) has the molecular formula C22H19ClFN5O2S and a molecular weight of 471.95 g/mol. Its IUPAC name is (E)-4-[(3S)-8-chloro-5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]but-3-en-1-one.
| Compound Name | (E)-4-[(3S)-8-chloro-5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]but-3-en-1-one |
|---|---|
| PubChem CID | 167004969 |
| Molecular Formula | C22H19ClFN5O2S |
| Molecular Weight | 471.95 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | (E)-4-[(3S)-8-chloro-5-methyl-4-sulfanylidene-2,3-dihydropyrido[3,2-b][1,4]oxazepin-3-yl]-1-[1-[(2-fluorophenyl)methyl]-1,2,4-triazol-3-yl]but-3-en-1-one |
| SMILES | CN1C(=S)[C@@H](/C=C/CC(=O)c2ncn(Cc3ccccc3F)n2)COc2cc(Cl)cnc21 |
| InChI | InChI=1S/C22H19ClFN5O2S/c1-28-21-19(9-16(23)10-25-21)31-12-15(22(28)32)6-4-8-18(30)20-26-13-29(27-20)11-14-5-2-3-7-17(14)24/h2-7,9-10,13,15H,8,11-12H2,1H3/b6-4+/t15-/m0/s1 |
| InChIKey | OFCDNGRTDJTOHJ-DRDHIDPGSA-N |
| XLogP | 4.12 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.95 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|