C26H25F4NO2 — CID 167005406
2-[[4-[(E)-2-[2-(fluoromethyl)-3-phenylphenyl]ethenyl]-2-methoxy-5-(trifluoromethyl)phenyl]methylamino]ethanol (PubChem CID 167005406) has the molecular formula C26H25F4NO2 and a molecular weight of 459.48 g/mol. Its IUPAC name is 2-[[4-[(E)-2-[2-(fluoromethyl)-3-phenylphenyl]ethenyl]-2-methoxy-5-(trifluoromethyl)phenyl]methylamino]ethanol.
| Compound Name | 2-[[4-[(E)-2-[2-(fluoromethyl)-3-phenylphenyl]ethenyl]-2-methoxy-5-(trifluoromethyl)phenyl]methylamino]ethanol |
|---|---|
| PubChem CID | 167005406 |
| Molecular Formula | C26H25F4NO2 |
| Molecular Weight | 459.48 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 2-[[4-[(E)-2-[2-(fluoromethyl)-3-phenylphenyl]ethenyl]-2-methoxy-5-(trifluoromethyl)phenyl]methylamino]ethanol |
| SMILES | COc1cc(/C=C/c2cccc(-c3ccccc3)c2CF)c(C(F)(F)F)cc1CNCCO |
| InChI | InChI=1S/C26H25F4NO2/c1-33-25-15-20(24(26(28,29)30)14-21(25)17-31-12-13-32)11-10-19-8-5-9-22(23(19)16-27)18-6-3-2-4-7-18/h2-11,14-15,31-32H,12-13,16-17H2,1H3/b11-10+ |
| InChIKey | YKMBFERCMVGJPF-ZHACJKMWSA-N |
| XLogP | 6.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.48 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|